C23H30N6O3S — CID 87348985
(3R,4S)-1-(N-cyano-C-thiomorpholin-4-ylcarbonimidoyl)-N-hydroxy-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-3-carboxamide (PubChem CID 87348985) has the molecular formula C23H30N6O3S and a molecular weight of 470.60 g/mol. Its IUPAC name is (3R,4S)-1-(N-cyano-C-thiomorpholin-4-ylcarbonimidoyl)-N-hydroxy-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-3-carboxamide.
| Compound Name | (3R,4S)-1-(N-cyano-C-thiomorpholin-4-ylcarbonimidoyl)-N-hydroxy-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 87348985 |
| Molecular Formula | C23H30N6O3S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | (3R,4S)-1-(N-cyano-C-thiomorpholin-4-ylcarbonimidoyl)-N-hydroxy-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-3-carboxamide |
| SMILES | N#C/N=C(\N1CCSCC1)N1CC[C@H](C(=O)N2CC[C@H](c3ccccc3)C2)[C@@H](C(=O)NO)C1 |
| InChI | InChI=1S/C23H30N6O3S/c24-16-25-23(27-10-12-33-13-11-27)29-9-7-19(20(15-29)21(30)26-32)22(31)28-8-6-18(14-28)17-4-2-1-3-5-17/h1-5,18-20,32H,6-15H2,(H,26,30)/b25-23+/t18-,19-,20-/m0/s1 |
| InChIKey | VCXMFKZTRJOPQJ-PDWVBJQTSA-N |
| XLogP | 1.33 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|