C20H27N3O5 — CID 90884756
[(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperidine-1-carbonyl)cyclohexyl]carbamic acid (PubChem CID 90884756) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is [(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperidine-1-carbonyl)cyclohexyl]carbamic acid.
| Compound Name | [(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperidine-1-carbonyl)cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 90884756 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | [(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperidine-1-carbonyl)cyclohexyl]carbamic acid |
| SMILES | O=C(O)N[C@@H]1CC[C@H](C(=O)N2CCC(c3ccccc3)CC2)[C@@H](C(=O)NO)C1 |
| InChI | InChI=1S/C20H27N3O5/c24-18(22-28)17-12-15(21-20(26)27)6-7-16(17)19(25)23-10-8-14(9-11-23)13-4-2-1-3-5-13/h1-5,14-17,21,28H,6-12H2,(H,22,24)(H,26,27)/t15-,16+,17+/m1/s1 |
| InChIKey | ZGDDMMPTPKYFAS-IKGGRYGDSA-N |
| XLogP | 1.95 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|