C22H31N3O5 — CID 87348582
[3-(hydroxycarbamoyl)-4-(4-phenylpiperidine-1-carbonyl)cyclohexyl] N,N-dimethylcarbamate (PubChem CID 87348582) has the molecular formula C22H31N3O5 and a molecular weight of 417.51 g/mol. Its IUPAC name is [3-(hydroxycarbamoyl)-4-(4-phenylpiperidine-1-carbonyl)cyclohexyl] N,N-dimethylcarbamate.
| Compound Name | [3-(hydroxycarbamoyl)-4-(4-phenylpiperidine-1-carbonyl)cyclohexyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 87348582 |
| Molecular Formula | C22H31N3O5 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | [3-(hydroxycarbamoyl)-4-(4-phenylpiperidine-1-carbonyl)cyclohexyl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)OC1CCC(C(=O)N2CCC(c3ccccc3)CC2)C(C(=O)NO)C1 |
| InChI | InChI=1S/C22H31N3O5/c1-24(2)22(28)30-17-8-9-18(19(14-17)20(26)23-29)21(27)25-12-10-16(11-13-25)15-6-4-3-5-7-15/h3-7,16-19,29H,8-14H2,1-2H3,(H,23,26) |
| InChIKey | KQXJMVRQNUDFAW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|