C23H33N3O5 — CID 91597305
[(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperidine-1-carbonyl)cyclohexyl]-propan-2-ylcarbamic acid (PubChem CID 91597305) has the molecular formula C23H33N3O5 and a molecular weight of 431.53 g/mol. Its IUPAC name is [(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperidine-1-carbonyl)cyclohexyl]-propan-2-ylcarbamic acid.
| Compound Name | [(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperidine-1-carbonyl)cyclohexyl]-propan-2-ylcarbamic acid |
|---|---|
| PubChem CID | 91597305 |
| Molecular Formula | C23H33N3O5 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | [(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperidine-1-carbonyl)cyclohexyl]-propan-2-ylcarbamic acid |
| SMILES | CC(C)N(C(=O)O)[C@@H]1CC[C@H](C(=O)N2CCC(c3ccccc3)CC2)[C@@H](C(=O)NO)C1 |
| InChI | InChI=1S/C23H33N3O5/c1-15(2)26(23(29)30)18-8-9-19(20(14-18)21(27)24-31)22(28)25-12-10-17(11-13-25)16-6-4-3-5-7-16/h3-7,15,17-20,31H,8-14H2,1-2H3,(H,24,27)(H,29,30)/t18-,19+,20+/m1/s1 |
| InChIKey | RUWQLTKLAPFENM-AABGKKOBSA-N |
| XLogP | 3.07 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|