C25H37N4O5+ — CID 87999270
4-[(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperidine-1-carbonyl)cyclohexyl]-4-methylpiperazin-4-ium-1-carboxylic acid (PubChem CID 87999270) has the molecular formula C25H37N4O5+ and a molecular weight of 473.59 g/mol. Its IUPAC name is 4-[(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperidine-1-carbonyl)cyclohexyl]-4-methylpiperazin-4-ium-1-carboxylic acid.
| Compound Name | 4-[(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperidine-1-carbonyl)cyclohexyl]-4-methylpiperazin-4-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 87999270 |
| Molecular Formula | C25H37N4O5+ |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | 4-[(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperidine-1-carbonyl)cyclohexyl]-4-methylpiperazin-4-ium-1-carboxylic acid |
| SMILES | C[N+]1([C@@H]2CC[C@H](C(=O)N3CCC(c4ccccc4)CC3)[C@@H](C(=O)NO)C2)CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C25H36N4O5/c1-29(15-13-28(14-16-29)25(32)33)20-7-8-21(22(17-20)23(30)26-34)24(31)27-11-9-19(10-12-27)18-5-3-2-4-6-18/h2-6,19-22H,7-17H2,1H3,(H2-,26,30,32,33,34)/p+1/t20-,21+,22+/m1/s1 |
| InChIKey | NHLNSTBTRUXSHZ-FSSWDIPSSA-O |
| XLogP | 2.12 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|