C22H31N3O5 — CID 174517256
3-(hydroxycarbamoyl)-2-[4-(3-propan-2-ylphenyl)piperidine-1-carbonyl]piperidine-1-carboxylic acid (PubChem CID 174517256) has the molecular formula C22H31N3O5 and a molecular weight of 417.51 g/mol. Its IUPAC name is 3-(hydroxycarbamoyl)-2-[4-(3-propan-2-ylphenyl)piperidine-1-carbonyl]piperidine-1-carboxylic acid.
| Compound Name | 3-(hydroxycarbamoyl)-2-[4-(3-propan-2-ylphenyl)piperidine-1-carbonyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 174517256 |
| Molecular Formula | C22H31N3O5 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 3-(hydroxycarbamoyl)-2-[4-(3-propan-2-ylphenyl)piperidine-1-carbonyl]piperidine-1-carboxylic acid |
| SMILES | CC(C)c1cccc(C2CCN(C(=O)C3C(C(=O)NO)CCCN3C(=O)O)CC2)c1 |
| InChI | InChI=1S/C22H31N3O5/c1-14(2)16-5-3-6-17(13-16)15-8-11-24(12-9-15)21(27)19-18(20(26)23-30)7-4-10-25(19)22(28)29/h3,5-6,13-15,18-19,30H,4,7-12H2,1-2H3,(H,23,26)(H,28,29) |
| InChIKey | VAFWEPYQXMSZHV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|