C18H25N3O3 — CID 59117548
(2S)-N-hydroxy-2-(4-phenylpiperidine-1-carbonyl)piperidine-3-carboxamide (PubChem CID 59117548) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is (2S)-N-hydroxy-2-(4-phenylpiperidine-1-carbonyl)piperidine-3-carboxamide.
| Compound Name | (2S)-N-hydroxy-2-(4-phenylpiperidine-1-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 59117548 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | (2S)-N-hydroxy-2-(4-phenylpiperidine-1-carbonyl)piperidine-3-carboxamide |
| SMILES | O=C(NO)C1CCCN[C@@H]1C(=O)N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H25N3O3/c22-17(20-24)15-7-4-10-19-16(15)18(23)21-11-8-14(9-12-21)13-5-2-1-3-6-13/h1-3,5-6,14-16,19,24H,4,7-12H2,(H,20,22)/t15?,16-/m0/s1 |
| InChIKey | KNBRKSHLLINANA-LYKKTTPLSA-N |
| XLogP | 1.27 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|