C21H27N3O5 — CID 87768101
3-[1-[7-(hydroxycarbamoyl)-5-azaspiro[2.5]octane-6-carbonyl]piperidin-4-yl]benzoic acid (PubChem CID 87768101) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is 3-[1-[7-(hydroxycarbamoyl)-5-azaspiro[2.5]octane-6-carbonyl]piperidin-4-yl]benzoic acid.
| Compound Name | 3-[1-[7-(hydroxycarbamoyl)-5-azaspiro[2.5]octane-6-carbonyl]piperidin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 87768101 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 3-[1-[7-(hydroxycarbamoyl)-5-azaspiro[2.5]octane-6-carbonyl]piperidin-4-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(C2CCN(C(=O)C3NCC4(CC4)CC3C(=O)NO)CC2)c1 |
| InChI | InChI=1S/C21H27N3O5/c25-18(23-29)16-11-21(6-7-21)12-22-17(16)19(26)24-8-4-13(5-9-24)14-2-1-3-15(10-14)20(27)28/h1-3,10,13,16-17,22,29H,4-9,11-12H2,(H,23,25)(H,27,28) |
| InChIKey | JYRMEOYRXGSXMF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|