C20H27N3O5 — CID 87348398
[3-(hydroxycarbamoyl)-4-(4-phenylpiperidine-1-carbonyl)cyclohexyl] carbamate (PubChem CID 87348398) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is [3-(hydroxycarbamoyl)-4-(4-phenylpiperidine-1-carbonyl)cyclohexyl] carbamate.
| Compound Name | [3-(hydroxycarbamoyl)-4-(4-phenylpiperidine-1-carbonyl)cyclohexyl] carbamate |
|---|---|
| PubChem CID | 87348398 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | [3-(hydroxycarbamoyl)-4-(4-phenylpiperidine-1-carbonyl)cyclohexyl] carbamate |
| SMILES | NC(=O)OC1CCC(C(=O)N2CCC(c3ccccc3)CC2)C(C(=O)NO)C1 |
| InChI | InChI=1S/C20H27N3O5/c21-20(26)28-15-6-7-16(17(12-15)18(24)22-27)19(25)23-10-8-14(9-11-23)13-4-2-1-3-5-13/h1-5,14-17,27H,6-12H2,(H2,21,26)(H,22,24) |
| InChIKey | SPVPIJAOHCISCT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|