C24H34N4O5 — CID 87348642
[3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)cyclohexyl] N-cyclopentylcarbamate (PubChem CID 87348642) has the molecular formula C24H34N4O5 and a molecular weight of 458.56 g/mol. Its IUPAC name is [3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)cyclohexyl] N-cyclopentylcarbamate.
| Compound Name | [3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)cyclohexyl] N-cyclopentylcarbamate |
|---|---|
| PubChem CID | 87348642 |
| Molecular Formula | C24H34N4O5 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | [3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)cyclohexyl] N-cyclopentylcarbamate |
| SMILES | O=C(NC1CCCC1)OC1CCC(C(=O)N2CCN(c3ccccc3)CC2)C(C(=O)NO)C1 |
| InChI | InChI=1S/C24H34N4O5/c29-22(26-32)21-16-19(33-24(31)25-17-6-4-5-7-17)10-11-20(21)23(30)28-14-12-27(13-15-28)18-8-2-1-3-9-18/h1-3,8-9,17,19-21,32H,4-7,10-16H2,(H,25,31)(H,26,29) |
| InChIKey | RVJNSCREDHWRDN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|