C24H33N3O6 — CID 72798589
oxolan-3-yl N-[3-(hydroxycarbamoyl)-4-(3-phenylpyrrolidine-1-carbonyl)cyclohexyl]-N-methylcarbamate (PubChem CID 72798589) has the molecular formula C24H33N3O6 and a molecular weight of 459.54 g/mol. Its IUPAC name is oxolan-3-yl N-[3-(hydroxycarbamoyl)-4-(3-phenylpyrrolidine-1-carbonyl)cyclohexyl]-N-methylcarbamate.
| Compound Name | oxolan-3-yl N-[3-(hydroxycarbamoyl)-4-(3-phenylpyrrolidine-1-carbonyl)cyclohexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 72798589 |
| Molecular Formula | C24H33N3O6 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | oxolan-3-yl N-[3-(hydroxycarbamoyl)-4-(3-phenylpyrrolidine-1-carbonyl)cyclohexyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC1CCOC1)C1CCC(C(=O)N2CCC(c3ccccc3)C2)C(C(=O)NO)C1 |
| InChI | InChI=1S/C24H33N3O6/c1-26(24(30)33-19-10-12-32-15-19)18-7-8-20(21(13-18)22(28)25-31)23(29)27-11-9-17(14-27)16-5-3-2-4-6-16/h2-6,17-21,31H,7-15H2,1H3,(H,25,28) |
| InChIKey | ZVPGSYMKVATBDX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|