C25H35N3O6 — CID 11397337
oxan-4-yl N-[(3S,4S)-3-(hydroxycarbamoyl)-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]cyclohexyl]-N-methylcarbamate (PubChem CID 11397337) has the molecular formula C25H35N3O6 and a molecular weight of 473.57 g/mol. Its IUPAC name is oxan-4-yl N-[(3S,4S)-3-(hydroxycarbamoyl)-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]cyclohexyl]-N-methylcarbamate.
| Compound Name | oxan-4-yl N-[(3S,4S)-3-(hydroxycarbamoyl)-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]cyclohexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 11397337 |
| Molecular Formula | C25H35N3O6 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | oxan-4-yl N-[(3S,4S)-3-(hydroxycarbamoyl)-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]cyclohexyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC1CCOCC1)C1CC[C@H](C(=O)N2CC[C@H](c3ccccc3)C2)[C@@H](C(=O)NO)C1 |
| InChI | InChI=1S/C25H35N3O6/c1-27(25(31)34-20-10-13-33-14-11-20)19-7-8-21(22(15-19)23(29)26-32)24(30)28-12-9-18(16-28)17-5-3-2-4-6-17/h2-6,18-22,32H,7-16H2,1H3,(H,26,29)/t18-,19?,21-,22-/m0/s1 |
| InChIKey | CPYWUHHCZWZUDY-HQHXSWNVSA-N |
| XLogP | 2.54 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|