C22H29N3O6 — CID 87348214
oxolan-3-yl (3R,4S)-3-(hydroxycarbamoyl)-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-1-carboxylate (PubChem CID 87348214) has the molecular formula C22H29N3O6 and a molecular weight of 431.49 g/mol. Its IUPAC name is oxolan-3-yl (3R,4S)-3-(hydroxycarbamoyl)-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-1-carboxylate.
| Compound Name | oxolan-3-yl (3R,4S)-3-(hydroxycarbamoyl)-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87348214 |
| Molecular Formula | C22H29N3O6 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | oxolan-3-yl (3R,4S)-3-(hydroxycarbamoyl)-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-1-carboxylate |
| SMILES | O=C(NO)[C@H]1CN(C(=O)OC2CCOC2)CC[C@@H]1C(=O)N1CC[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C22H29N3O6/c26-20(23-29)19-13-25(22(28)31-17-8-11-30-14-17)10-7-18(19)21(27)24-9-6-16(12-24)15-4-2-1-3-5-15/h1-5,16-19,29H,6-14H2,(H,23,26)/t16-,17?,18-,19-/m0/s1 |
| InChIKey | AMRVPMCXAPTMQS-RNLLHNEJSA-N |
| XLogP | 1.37 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|