C22H31N3O3 — CID 11372567
trans-(1S,2S)-N-hydroxy-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]-5-pyrrolidin-1-ylcyclohexane-1-carboxamide (PubChem CID 11372567) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is trans-(1S,2S)-N-hydroxy-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]-5-pyrrolidin-1-ylcyclohexane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-hydroxy-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]-5-pyrrolidin-1-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 11372567 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | trans-(1S,2S)-N-hydroxy-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]-5-pyrrolidin-1-ylcyclohexane-1-carboxamide |
| SMILES | O=C(NO)[C@H]1CC(N2CCCC2)CC[C@@H]1C(=O)N1CC[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C22H31N3O3/c26-21(23-28)20-14-18(24-11-4-5-12-24)8-9-19(20)22(27)25-13-10-17(15-25)16-6-2-1-3-7-16/h1-3,6-7,17-20,28H,4-5,8-15H2,(H,23,26)/t17-,18?,19-,20-/m0/s1 |
| InChIKey | BLTJFRLHWUWTHK-GFDAQUBOSA-N |
| XLogP | 2.39 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|