C20H24F3N3O3 — CID 91251044
N-hydroxy-6-[3-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carbonyl]-1-azaspiro[2.5]octane-5-carboxamide (PubChem CID 91251044) has the molecular formula C20H24F3N3O3 and a molecular weight of 411.42 g/mol. Its IUPAC name is N-hydroxy-6-[3-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carbonyl]-1-azaspiro[2.5]octane-5-carboxamide.
| Compound Name | N-hydroxy-6-[3-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carbonyl]-1-azaspiro[2.5]octane-5-carboxamide |
|---|---|
| PubChem CID | 91251044 |
| Molecular Formula | C20H24F3N3O3 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | N-hydroxy-6-[3-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carbonyl]-1-azaspiro[2.5]octane-5-carboxamide |
| SMILES | O=C(NO)C1CC2(CCC1C(=O)N1CCC(c3ccc(C(F)(F)F)cc3)C1)CN2 |
| InChI | InChI=1S/C20H24F3N3O3/c21-20(22,23)14-3-1-12(2-4-14)13-6-8-26(10-13)18(28)15-5-7-19(11-24-19)9-16(15)17(27)25-29/h1-4,13,15-16,24,29H,5-11H2,(H,25,27) |
| InChIKey | AUWRVYCSCPBQJK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|