C25H27F2N3O5 — CID 87928721
1-[4-(difluoromethoxy)benzoyl]-N-hydroxy-4-(3-phenylpyrrolidine-1-carbonyl)piperidine-3-carboxamide (PubChem CID 87928721) has the molecular formula C25H27F2N3O5 and a molecular weight of 487.50 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)benzoyl]-N-hydroxy-4-(3-phenylpyrrolidine-1-carbonyl)piperidine-3-carboxamide.
| Compound Name | 1-[4-(difluoromethoxy)benzoyl]-N-hydroxy-4-(3-phenylpyrrolidine-1-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 87928721 |
| Molecular Formula | C25H27F2N3O5 |
| Molecular Weight | 487.50 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 1-[4-(difluoromethoxy)benzoyl]-N-hydroxy-4-(3-phenylpyrrolidine-1-carbonyl)piperidine-3-carboxamide |
| SMILES | O=C(NO)C1CN(C(=O)c2ccc(OC(F)F)cc2)CCC1C(=O)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C25H27F2N3O5/c26-25(27)35-19-8-6-17(7-9-19)23(32)30-13-11-20(21(15-30)22(31)28-34)24(33)29-12-10-18(14-29)16-4-2-1-3-5-16/h1-9,18,20-21,25,34H,10-15H2,(H,28,31) |
| InChIKey | HISVCZPYEWIKDU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|