C27H30N6O3 — CID 87348590
(3R,4S)-1-[N-cyano-C-(1,3-dihydroisoindol-2-yl)carbonimidoyl]-N-hydroxy-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-3-carboxamide (PubChem CID 87348590) has the molecular formula C27H30N6O3 and a molecular weight of 486.58 g/mol. Its IUPAC name is (3R,4S)-1-[N-cyano-C-(1,3-dihydroisoindol-2-yl)carbonimidoyl]-N-hydroxy-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-3-carboxamide.
| Compound Name | (3R,4S)-1-[N-cyano-C-(1,3-dihydroisoindol-2-yl)carbonimidoyl]-N-hydroxy-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 87348590 |
| Molecular Formula | C27H30N6O3 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | (3R,4S)-1-[N-cyano-C-(1,3-dihydroisoindol-2-yl)carbonimidoyl]-N-hydroxy-4-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-3-carboxamide |
| SMILES | N#C/N=C(\N1Cc2ccccc2C1)N1CC[C@H](C(=O)N2CC[C@H](c3ccccc3)C2)[C@@H](C(=O)NO)C1 |
| InChI | InChI=1S/C27H30N6O3/c28-18-29-27(33-15-20-8-4-5-9-21(20)16-33)32-13-11-23(24(17-32)25(34)30-36)26(35)31-12-10-22(14-31)19-6-2-1-3-7-19/h1-9,22-24,36H,10-17H2,(H,30,34)/b29-27-/t22-,23-,24-/m0/s1 |
| InChIKey | MTGKSKWDBGMYEL-FTMHZMJPSA-N |
| XLogP | 2.30 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|