C21H26N4O5 — CID 87348635
(2S,3S,5S)-N-hydroxy-5-[(5-methyl-1,2-oxazol-3-yl)oxy]-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-3-carboxamide (PubChem CID 87348635) has the molecular formula C21H26N4O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is (2S,3S,5S)-N-hydroxy-5-[(5-methyl-1,2-oxazol-3-yl)oxy]-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-3-carboxamide.
| Compound Name | (2S,3S,5S)-N-hydroxy-5-[(5-methyl-1,2-oxazol-3-yl)oxy]-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 87348635 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (2S,3S,5S)-N-hydroxy-5-[(5-methyl-1,2-oxazol-3-yl)oxy]-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]piperidine-3-carboxamide |
| SMILES | Cc1cc(O[C@@H]2CN[C@H](C(=O)N3CC[C@H](c4ccccc4)C3)[C@@H](C(=O)NO)C2)no1 |
| InChI | InChI=1S/C21H26N4O5/c1-13-9-18(24-30-13)29-16-10-17(20(26)23-28)19(22-11-16)21(27)25-8-7-15(12-25)14-5-3-2-4-6-14/h2-6,9,15-17,19,22,28H,7-8,10-12H2,1H3,(H,23,26)/t15-,16-,17-,19-/m0/s1 |
| InChIKey | HZNPBCIUICFXAI-DWRORGKVSA-N |
| XLogP | 1.23 |
| TPSA | 116.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|