C21H25NO2 — CID 57330536
(3Z,3aR,4aS,8aR,9aR)-3-[(2-aminophenyl)methylidene]-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one (PubChem CID 57330536) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is (3Z,3aR,4aS,8aR,9aR)-3-[(2-aminophenyl)methylidene]-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | (3Z,3aR,4aS,8aR,9aR)-3-[(2-aminophenyl)methylidene]-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 57330536 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (3Z,3aR,4aS,8aR,9aR)-3-[(2-aminophenyl)methylidene]-8a-methyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| SMILES | C=C1CCC[C@]2(C)C[C@H]3OC(=O)/C(=C\c4ccccc4N)[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C21H25NO2/c1-13-6-5-9-21(2)12-19-15(11-17(13)21)16(20(23)24-19)10-14-7-3-4-8-18(14)22/h3-4,7-8,10,15,17,19H,1,5-6,9,11-12,22H2,2H3/b16-10-/t15-,17+,19-,21-/m1/s1 |
| InChIKey | LEFUTEJJWHNXCQ-GDSXLQTHSA-N |
| XLogP | 4.35 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|