C19H25NO3 — CID 57330601
5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-6-methoxy-2,3-dihydroisoindol-1-one (PubChem CID 57330601) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-6-methoxy-2,3-dihydroisoindol-1-one.
| Compound Name | 5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-6-methoxy-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 57330601 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-6-methoxy-2,3-dihydroisoindol-1-one |
| SMILES | COc1cc2c(c(O)c1C/C=C(\C)CCC=C(C)C)CNC2=O |
| InChI | InChI=1S/C19H25NO3/c1-12(2)6-5-7-13(3)8-9-14-17(23-4)10-15-16(18(14)21)11-20-19(15)22/h6,8,10,21H,5,7,9,11H2,1-4H3,(H,20,22)/b13-8+ |
| InChIKey | AXUYTAQZPXNVBF-MDWZMJQESA-N |
| XLogP | 3.88 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|