About [3-(dimethylamino)-2,2-dimethylpropyl] (E)-dec-2-enoate
[3-(dimethylamino)-2,2-dimethylpropyl] (E)-dec-2-enoate (PubChem CID 57331714) has the molecular formula C17H33NO2
and a molecular weight of 283.46 g/mol. Its IUPAC name is [3-(dimethylamino)-2,2-dimethylpropyl] (E)-dec-2-enoate.
Molecular Properties
| Compound Name | [3-(dimethylamino)-2,2-dimethylpropyl] (E)-dec-2-enoate |
| PubChem CID | 57331714 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | [3-(dimethylamino)-2,2-dimethylpropyl] (E)-dec-2-enoate |
| SMILES | CCCCCCC/C=C/C(=O)OCC(C)(C)CN(C)C |
| InChI | InChI=1S/C17H33NO2/c1-6-7-8-9-10-11-12-13-16(19)20-15-17(2,3)14-18(4)5/h12-13H,6-11,14-15H2,1-5H3/b13-12+ |
| InChIKey | GNGYGLIDGHEDLX-OUKQBFOZSA-N |
| XLogP | 4.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(dimethylamino)-2,2-dimethylpropyl] (E)-dec-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(dimethylamino)-2,2-dimethylpropyl] (E)-dec-2-enoate?
The IUPAC name of [3-(dimethylamino)-2,2-dimethylpropyl] (E)-dec-2-enoate (CID 57331714) is [3-(dimethylamino)-2,2-dimethylpropyl] (E)-dec-2-enoate.
What is the SMILES notation for [3-(dimethylamino)-2,2-dimethylpropyl] (E)-dec-2-enoate?
The canonical SMILES for [3-(dimethylamino)-2,2-dimethylpropyl] (E)-dec-2-enoate is CCCCCCC/C=C/C(=O)OCC(C)(C)CN(C)C.
What is the InChIKey of [3-(dimethylamino)-2,2-dimethylpropyl] (E)-dec-2-enoate?
The InChIKey is GNGYGLIDGHEDLX-OUKQBFOZSA-N. The full InChI is InChI=1S/C17H33NO2/c1-6-7-8-9-10-11-12-13-16(19)20-15-17(2,3)14-18(4)5/h12-13H,6-11,14-15H2,1-5H3/b13-12+.
What are the key properties of [3-(dimethylamino)-2,2-dimethylpropyl] (E)-dec-2-enoate?
[3-(dimethylamino)-2,2-dimethylpropyl] (E)-dec-2-enoate has a molecular weight of 283.46 g/mol, XLogP of 4.03, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(dimethylamino)-2,2-dimethylpropyl] (E)-dec-2-enoate is sourced from PubChem (CID 57331714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).