C18H32OSi — CID 57333047
tert-butyl-[2-[(1E,4E,8Z)-cyclodeca-1,4,8-trien-1-yl]ethoxy]-dimethylsilane (PubChem CID 57333047) has the molecular formula C18H32OSi and a molecular weight of 292.54 g/mol. Its IUPAC name is tert-butyl-[2-[(1E,4E,8Z)-cyclodeca-1,4,8-trien-1-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(1E,4E,8Z)-cyclodeca-1,4,8-trien-1-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 57333047 |
| Molecular Formula | C18H32OSi |
| Molecular Weight | 292.54 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | tert-butyl-[2-[(1E,4E,8Z)-cyclodeca-1,4,8-trien-1-yl]ethoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC/C1=C/C/C=C/CC/C=C\C1 |
| InChI | InChI=1S/C18H32OSi/c1-18(2,3)20(4,5)19-16-15-17-13-11-9-7-6-8-10-12-14-17/h7,9-10,12-13H,6,8,11,14-16H2,1-5H3/b9-7+,12-10-,17-13+ |
| InChIKey | XNPWYLSSQURSJW-UVKHGHLYSA-N |
| XLogP | 6.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.54 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|