C25H28O9 — CID 57333634
(5S,5aR,8aR,9R)-9-[4-(1-ethoxyethoxy)-3,5-dimethoxyphenyl]-5-hydroxy-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one (PubChem CID 57333634) has the molecular formula C25H28O9 and a molecular weight of 472.49 g/mol. Its IUPAC name is (5S,5aR,8aR,9R)-9-[4-(1-ethoxyethoxy)-3,5-dimethoxyphenyl]-5-hydroxy-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one.
| Compound Name | (5S,5aR,8aR,9R)-9-[4-(1-ethoxyethoxy)-3,5-dimethoxyphenyl]-5-hydroxy-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
|---|---|
| PubChem CID | 57333634 |
| Molecular Formula | C25H28O9 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | (5S,5aR,8aR,9R)-9-[4-(1-ethoxyethoxy)-3,5-dimethoxyphenyl]-5-hydroxy-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
| SMILES | CCOC(C)Oc1c(OC)cc([C@@H]2c3cc4c(cc3[C@@H](O)[C@H]3COC(=O)[C@H]23)OCO4)cc1OC |
| InChI | InChI=1S/C25H28O9/c1-5-30-12(2)34-24-19(28-3)6-13(7-20(24)29-4)21-14-8-17-18(33-11-32-17)9-15(14)23(26)16-10-31-25(27)22(16)21/h6-9,12,16,21-23,26H,5,10-11H2,1-4H3/t12?,16-,21+,22-,23+/m0/s1 |
| InChIKey | BWRRBCXTLJTHRW-ZBHQFOLTSA-N |
| XLogP | 3.16 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|