C36H30O12 — CID 67269804
benzyl [4-(5-hydroxy-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-9-yl)-2-methoxy-6-phenylmethoxycarbonyloxyphenyl] carbonate (PubChem CID 67269804) has the molecular formula C36H30O12 and a molecular weight of 654.62 g/mol. Its IUPAC name is benzyl [4-(5-hydroxy-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-9-yl)-2-methoxy-6-phenylmethoxycarbonyloxyphenyl] carbonate.
| Compound Name | benzyl [4-(5-hydroxy-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-9-yl)-2-methoxy-6-phenylmethoxycarbonyloxyphenyl] carbonate |
|---|---|
| PubChem CID | 67269804 |
| Molecular Formula | C36H30O12 |
| Molecular Weight | 654.62 g/mol |
| Exact Mass | 654.17 |
| IUPAC Name | benzyl [4-(5-hydroxy-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-9-yl)-2-methoxy-6-phenylmethoxycarbonyloxyphenyl] carbonate |
| SMILES | COc1cc(C2c3cc4c(cc3C(O)C3COC(=O)C23)OCO4)cc(OC(=O)OCc2ccccc2)c1OC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H30O12/c1-41-28-12-22(30-23-14-26-27(46-19-45-26)15-24(23)32(37)25-18-42-34(38)31(25)30)13-29(47-35(39)43-16-20-8-4-2-5-9-20)33(28)48-36(40)44-17-21-10-6-3-7-11-21/h2-15,25,30-32,37H,16-19H2,1H3 |
| InChIKey | GPDNXBGJSKOINW-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 145.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|