C32H30O9 — CID 15839852
[4-[(5R,5aR,8aR,9S)-6-oxo-9-prop-2-enyl-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-2,6-dimethoxyphenyl] benzyl carbonate (PubChem CID 15839852) has the molecular formula C32H30O9 and a molecular weight of 558.58 g/mol. Its IUPAC name is [4-[(5R,5aR,8aR,9S)-6-oxo-9-prop-2-enyl-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-2,6-dimethoxyphenyl] benzyl carbonate.
| Compound Name | [4-[(5R,5aR,8aR,9S)-6-oxo-9-prop-2-enyl-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-2,6-dimethoxyphenyl] benzyl carbonate |
|---|---|
| PubChem CID | 15839852 |
| Molecular Formula | C32H30O9 |
| Molecular Weight | 558.58 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | [4-[(5R,5aR,8aR,9S)-6-oxo-9-prop-2-enyl-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-2,6-dimethoxyphenyl] benzyl carbonate |
| SMILES | C=CC[C@@H]1c2cc3c(cc2[C@@H](c2cc(OC)c(OC(=O)OCc4ccccc4)c(OC)c2)[C@H]2C(=O)OC[C@@H]21)OCO3 |
| InChI | InChI=1S/C32H30O9/c1-4-8-20-21-13-24-25(40-17-39-24)14-22(21)28(29-23(20)16-37-31(29)33)19-11-26(35-2)30(27(12-19)36-3)41-32(34)38-15-18-9-6-5-7-10-18/h4-7,9-14,20,23,28-29H,1,8,15-17H2,2-3H3/t20-,23-,28-,29+/m1/s1 |
| InChIKey | CQDWHYMZMQNCPH-YWZSZGKRSA-N |
| XLogP | 5.74 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.58 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|