C31H30O9S — CID 11319169
[4-[(5S,5aR,8aR,9R)-5-ethylsulfanyl-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-9-yl]-2,6-dimethoxyphenyl] benzyl carbonate (PubChem CID 11319169) has the molecular formula C31H30O9S and a molecular weight of 578.64 g/mol. Its IUPAC name is [4-[(5S,5aR,8aR,9R)-5-ethylsulfanyl-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-9-yl]-2,6-dimethoxyphenyl] benzyl carbonate.
| Compound Name | [4-[(5S,5aR,8aR,9R)-5-ethylsulfanyl-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-9-yl]-2,6-dimethoxyphenyl] benzyl carbonate |
|---|---|
| PubChem CID | 11319169 |
| Molecular Formula | C31H30O9S |
| Molecular Weight | 578.64 g/mol |
| Exact Mass | 578.16 |
| IUPAC Name | [4-[(5S,5aR,8aR,9R)-5-ethylsulfanyl-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-9-yl]-2,6-dimethoxyphenyl] benzyl carbonate |
| SMILES | CCS[C@@H]1c2cc3c(cc2[C@@H](c2cc(OC)c(OC(=O)OCc4ccccc4)c(OC)c2)[C@H]2C(=O)OC[C@@H]21)OCO3 |
| InChI | InChI=1S/C31H30O9S/c1-4-41-29-20-13-23-22(38-16-39-23)12-19(20)26(27-21(29)15-36-30(27)32)18-10-24(34-2)28(25(11-18)35-3)40-31(33)37-14-17-8-6-5-7-9-17/h5-13,21,26-27,29H,4,14-16H2,1-3H3/t21-,26+,27-,29+/m0/s1 |
| InChIKey | BUKITVKXRKYBJR-XNLUEZIFSA-N |
| XLogP | 5.88 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.64 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|