C17H14N6OS — CID 57334271
4-(4-pyridin-3-yl-8-thia-3,5,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)morpholine (PubChem CID 57334271) has the molecular formula C17H14N6OS and a molecular weight of 350.41 g/mol. Its IUPAC name is 4-(4-pyridin-3-yl-8-thia-3,5,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)morpholine.
| Compound Name | 4-(4-pyridin-3-yl-8-thia-3,5,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)morpholine |
|---|---|
| PubChem CID | 57334271 |
| Molecular Formula | C17H14N6OS |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 4-(4-pyridin-3-yl-8-thia-3,5,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)morpholine |
| SMILES | c1cncc(-c2nc(N3CCOCC3)c3sc4nnccc4c3n2)c1 |
| InChI | InChI=1S/C17H14N6OS/c1-2-11(10-18-4-1)15-20-13-12-3-5-19-22-17(12)25-14(13)16(21-15)23-6-8-24-9-7-23/h1-5,10H,6-9H2 |
| InChIKey | IRBILRXRYKTEJK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 76.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |