C20H28ClN3O4S — CID 57334668
4-methoxy-N-[3-(1-methoxyethyl)phenyl]-3-piperazin-1-ylbenzenesulfonamide;hydrochloride (PubChem CID 57334668) has the molecular formula C20H28ClN3O4S and a molecular weight of 441.98 g/mol. Its IUPAC name is 4-methoxy-N-[3-(1-methoxyethyl)phenyl]-3-piperazin-1-ylbenzenesulfonamide;hydrochloride.
| Compound Name | 4-methoxy-N-[3-(1-methoxyethyl)phenyl]-3-piperazin-1-ylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 57334668 |
| Molecular Formula | C20H28ClN3O4S |
| Molecular Weight | 441.98 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 4-methoxy-N-[3-(1-methoxyethyl)phenyl]-3-piperazin-1-ylbenzenesulfonamide;hydrochloride |
| SMILES | COc1ccc(S(=O)(=O)Nc2cccc(C(C)OC)c2)cc1N1CCNCC1.Cl |
| InChI | InChI=1S/C20H27N3O4S.ClH/c1-15(26-2)16-5-4-6-17(13-16)22-28(24,25)18-7-8-20(27-3)19(14-18)23-11-9-21-10-12-23;/h4-8,13-15,21-22H,9-12H2,1-3H3;1H |
| InChIKey | SDLMZRIFWIIICH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.98 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |