C24H30O — CID 57336731
(3R)-3-hexyl-4,4-diphenylcyclohexan-1-one (PubChem CID 57336731) has the molecular formula C24H30O and a molecular weight of 334.50 g/mol. Its IUPAC name is (3R)-3-hexyl-4,4-diphenylcyclohexan-1-one.
| Compound Name | (3R)-3-hexyl-4,4-diphenylcyclohexan-1-one |
|---|---|
| PubChem CID | 57336731 |
| Molecular Formula | C24H30O |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (3R)-3-hexyl-4,4-diphenylcyclohexan-1-one |
| SMILES | CCCCCC[C@@H]1CC(=O)CCC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H30O/c1-2-3-4-7-16-22-19-23(25)17-18-24(22,20-12-8-5-9-13-20)21-14-10-6-11-15-21/h5-6,8-15,22H,2-4,7,16-19H2,1H3/t22-/m1/s1 |
| InChIKey | YYKXKOOWQZKCFW-JOCHJYFZSA-N |
| XLogP | 6.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|