C24H20O5 — CID 57336948
phenyl-[3-(3,4,5-trimethoxyphenyl)-1-benzofuran-2-yl]methanone (PubChem CID 57336948) has the molecular formula C24H20O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is phenyl-[3-(3,4,5-trimethoxyphenyl)-1-benzofuran-2-yl]methanone.
| Compound Name | phenyl-[3-(3,4,5-trimethoxyphenyl)-1-benzofuran-2-yl]methanone |
|---|---|
| PubChem CID | 57336948 |
| Molecular Formula | C24H20O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | phenyl-[3-(3,4,5-trimethoxyphenyl)-1-benzofuran-2-yl]methanone |
| SMILES | COc1cc(-c2c(C(=O)c3ccccc3)oc3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C24H20O5/c1-26-19-13-16(14-20(27-2)23(19)28-3)21-17-11-7-8-12-18(17)29-24(21)22(25)15-9-5-4-6-10-15/h4-14H,1-3H3 |
| InChIKey | WIXYSHCBYSEQGS-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |