C18H23NO4 — CID 57336976
methyl (2S)-2-[[(2S)-2-methoxy-2-phenylpent-3-ynoyl]amino]-3-methylbutanoate (PubChem CID 57336976) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-methoxy-2-phenylpent-3-ynoyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-methoxy-2-phenylpent-3-ynoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 57336976 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-methoxy-2-phenylpent-3-ynoyl]amino]-3-methylbutanoate |
| SMILES | CC#C[C@](OC)(C(=O)N[C@H](C(=O)OC)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H23NO4/c1-6-12-18(23-5,14-10-8-7-9-11-14)17(21)19-15(13(2)3)16(20)22-4/h7-11,13,15H,1-5H3,(H,19,21)/t15-,18+/m0/s1 |
| InChIKey | FRSAZRQIVXLZAO-MAUKXSAKSA-N |
| XLogP | 1.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|