C15H15N3S — CID 57338139
8-butyl-13-thia-8,10,15-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11,14-hexaene (PubChem CID 57338139) has the molecular formula C15H15N3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 8-butyl-13-thia-8,10,15-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11,14-hexaene.
| Compound Name | 8-butyl-13-thia-8,10,15-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11,14-hexaene |
|---|---|
| PubChem CID | 57338139 |
| Molecular Formula | C15H15N3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 8-butyl-13-thia-8,10,15-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11,14-hexaene |
| SMILES | CCCCn1c2ccccc2c2nc3sccn3c21 |
| InChI | InChI=1S/C15H15N3S/c1-2-3-8-17-12-7-5-4-6-11(12)13-14(17)18-9-10-19-15(18)16-13/h4-7,9-10H,2-3,8H2,1H3 |
| InChIKey | BUQODTAWWWGEIM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |