C3H6O4 — CID 57339130
(1R)-1-(dioxiran-3-yl)ethane-1,2-diol (PubChem CID 57339130) has the molecular formula C3H6O4 and a molecular weight of 106.08 g/mol. Its IUPAC name is (1R)-1-(dioxiran-3-yl)ethane-1,2-diol.
| Compound Name | (1R)-1-(dioxiran-3-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 57339130 |
| Molecular Formula | C3H6O4 |
| Molecular Weight | 106.08 g/mol |
| Exact Mass | 106.03 |
| IUPAC Name | (1R)-1-(dioxiran-3-yl)ethane-1,2-diol |
| SMILES | OC[C@@H](O)C1OO1 |
| InChI | InChI=1S/C3H6O4/c4-1-2(5)3-6-7-3/h2-5H,1H2/t2-/m1/s1 |
| InChIKey | YJYNSCFFHXPCMQ-UWTATZPHSA-N |
| XLogP | -1.37 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 106.08 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|