C37H32N2O2 — CID 57340933
methyl (2R,3R)-3-anilino-2-(1-benzylindol-3-yl)-2,3-diphenylpropanoate (PubChem CID 57340933) has the molecular formula C37H32N2O2 and a molecular weight of 536.68 g/mol. Its IUPAC name is methyl (2R,3R)-3-anilino-2-(1-benzylindol-3-yl)-2,3-diphenylpropanoate.
| Compound Name | methyl (2R,3R)-3-anilino-2-(1-benzylindol-3-yl)-2,3-diphenylpropanoate |
|---|---|
| PubChem CID | 57340933 |
| Molecular Formula | C37H32N2O2 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | methyl (2R,3R)-3-anilino-2-(1-benzylindol-3-yl)-2,3-diphenylpropanoate |
| SMILES | COC(=O)[C@](c1ccccc1)(c1cn(Cc2ccccc2)c2ccccc12)[C@H](Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H32N2O2/c1-41-36(40)37(30-20-10-4-11-21-30,35(29-18-8-3-9-19-29)38-31-22-12-5-13-23-31)33-27-39(26-28-16-6-2-7-17-28)34-25-15-14-24-32(33)34/h2-25,27,35,38H,26H2,1H3/t35-,37-/m1/s1 |
| InChIKey | NWSIOIPDZHNDEZ-ZEEKBPLESA-N |
| XLogP | 8.00 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |