About (1Z,3R)-2-bromo-3-methyl-1-phenylhepta-1,6-dien-3-ol
(1Z,3R)-2-bromo-3-methyl-1-phenylhepta-1,6-dien-3-ol (PubChem CID 57342153) has the molecular formula C14H17BrO
and a molecular weight of 281.19 g/mol. Its IUPAC name is (1Z,3R)-2-bromo-3-methyl-1-phenylhepta-1,6-dien-3-ol.
Molecular Properties
| Compound Name | (1Z,3R)-2-bromo-3-methyl-1-phenylhepta-1,6-dien-3-ol |
| PubChem CID | 57342153 |
| Molecular Formula | C14H17BrO |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | (1Z,3R)-2-bromo-3-methyl-1-phenylhepta-1,6-dien-3-ol |
| SMILES | C=CCC[C@@](C)(O)/C(Br)=C/c1ccccc1 |
| InChI | InChI=1S/C14H17BrO/c1-3-4-10-14(2,16)13(15)11-12-8-6-5-7-9-12/h3,5-9,11,16H,1,4,10H2,2H3/b13-11-/t14-/m1/s1 |
| InChIKey | HBHQYWYKUCSNBN-YBEMTRGBSA-N |
| XLogP | 4.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1Z,3R)-2-bromo-3-methyl-1-phenylhepta-1,6-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,3R)-2-bromo-3-methyl-1-phenylhepta-1,6-dien-3-ol?
The IUPAC name of (1Z,3R)-2-bromo-3-methyl-1-phenylhepta-1,6-dien-3-ol (CID 57342153) is (1Z,3R)-2-bromo-3-methyl-1-phenylhepta-1,6-dien-3-ol.
What is the SMILES notation for (1Z,3R)-2-bromo-3-methyl-1-phenylhepta-1,6-dien-3-ol?
The canonical SMILES for (1Z,3R)-2-bromo-3-methyl-1-phenylhepta-1,6-dien-3-ol is C=CCC[C@@](C)(O)/C(Br)=C/c1ccccc1.
What is the InChIKey of (1Z,3R)-2-bromo-3-methyl-1-phenylhepta-1,6-dien-3-ol?
The InChIKey is HBHQYWYKUCSNBN-YBEMTRGBSA-N. The full InChI is InChI=1S/C14H17BrO/c1-3-4-10-14(2,16)13(15)11-12-8-6-5-7-9-12/h3,5-9,11,16H,1,4,10H2,2H3/b13-11-/t14-/m1/s1.
What are the key properties of (1Z,3R)-2-bromo-3-methyl-1-phenylhepta-1,6-dien-3-ol?
(1Z,3R)-2-bromo-3-methyl-1-phenylhepta-1,6-dien-3-ol has a molecular weight of 281.19 g/mol, XLogP of 4.14, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,3R)-2-bromo-3-methyl-1-phenylhepta-1,6-dien-3-ol is sourced from PubChem (CID 57342153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).