C17H12F3NO2 — CID 57343105
(4S)-4-benzyl-2-[4-(trifluoromethyl)phenyl]-4H-1,3-oxazol-5-one (PubChem CID 57343105) has the molecular formula C17H12F3NO2 and a molecular weight of 319.28 g/mol. Its IUPAC name is (4S)-4-benzyl-2-[4-(trifluoromethyl)phenyl]-4H-1,3-oxazol-5-one.
| Compound Name | (4S)-4-benzyl-2-[4-(trifluoromethyl)phenyl]-4H-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 57343105 |
| Molecular Formula | C17H12F3NO2 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | (4S)-4-benzyl-2-[4-(trifluoromethyl)phenyl]-4H-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc(C(F)(F)F)cc2)=N[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C17H12F3NO2/c18-17(19,20)13-8-6-12(7-9-13)15-21-14(16(22)23-15)10-11-4-2-1-3-5-11/h1-9,14H,10H2/t14-/m0/s1 |
| InChIKey | KDBUKMGHSWHHEL-AWEZNQCLSA-N |
| XLogP | 3.62 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |