C17H22O3S — CID 57343126
S-(4-methylphenyl) 2-[(2R,4aS,8aR)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]ethanethioate (PubChem CID 57343126) has the molecular formula C17H22O3S and a molecular weight of 306.43 g/mol. Its IUPAC name is S-(4-methylphenyl) 2-[(2R,4aS,8aR)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]ethanethioate.
| Compound Name | S-(4-methylphenyl) 2-[(2R,4aS,8aR)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]ethanethioate |
|---|---|
| PubChem CID | 57343126 |
| Molecular Formula | C17H22O3S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | S-(4-methylphenyl) 2-[(2R,4aS,8aR)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]ethanethioate |
| SMILES | Cc1ccc(SC(=O)C[C@H]2CC[C@@H]3OCCC[C@H]3O2)cc1 |
| InChI | InChI=1S/C17H22O3S/c1-12-4-7-14(8-5-12)21-17(18)11-13-6-9-15-16(20-13)3-2-10-19-15/h4-5,7-8,13,15-16H,2-3,6,9-11H2,1H3/t13-,15+,16-/m1/s1 |
| InChIKey | NRIHXUGDSLCJCK-VNQPRFMTSA-N |
| XLogP | 3.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|