C17H22O4S — CID 57343128
S-(4-methylphenyl) 2-[(2R,4S,4aS,8aR)-4-hydroxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]ethanethioate (PubChem CID 57343128) has the molecular formula C17H22O4S and a molecular weight of 322.43 g/mol. Its IUPAC name is S-(4-methylphenyl) 2-[(2R,4S,4aS,8aR)-4-hydroxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]ethanethioate.
| Compound Name | S-(4-methylphenyl) 2-[(2R,4S,4aS,8aR)-4-hydroxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]ethanethioate |
|---|---|
| PubChem CID | 57343128 |
| Molecular Formula | C17H22O4S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | S-(4-methylphenyl) 2-[(2R,4S,4aS,8aR)-4-hydroxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]ethanethioate |
| SMILES | Cc1ccc(SC(=O)C[C@H]2C[C@H](O)[C@@H]3OCCC[C@H]3O2)cc1 |
| InChI | InChI=1S/C17H22O4S/c1-11-4-6-13(7-5-11)22-16(19)10-12-9-14(18)17-15(21-12)3-2-8-20-17/h4-7,12,14-15,17-18H,2-3,8-10H2,1H3/t12-,14+,15-,17+/m1/s1 |
| InChIKey | XALSTSPSYJNCFH-JWDQPFGJSA-N |
| XLogP | 2.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|