C23H35FO6S — CID 91013378
6-fluoro-4-methoxy-2-methyl-5-phenylsulfanyloxan-3-ol;4-methoxy-2,5,6-trimethyloxane-3-carbaldehyde (PubChem CID 91013378) has the molecular formula C23H35FO6S and a molecular weight of 458.59 g/mol. Its IUPAC name is 6-fluoro-4-methoxy-2-methyl-5-phenylsulfanyloxan-3-ol;4-methoxy-2,5,6-trimethyloxane-3-carbaldehyde.
| Compound Name | 6-fluoro-4-methoxy-2-methyl-5-phenylsulfanyloxan-3-ol;4-methoxy-2,5,6-trimethyloxane-3-carbaldehyde |
|---|---|
| PubChem CID | 91013378 |
| Molecular Formula | C23H35FO6S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 6-fluoro-4-methoxy-2-methyl-5-phenylsulfanyloxan-3-ol;4-methoxy-2,5,6-trimethyloxane-3-carbaldehyde |
| SMILES | COC1C(C)C(C)OC(C)C1C=O.COC1C(O)C(C)OC(F)C1Sc1ccccc1 |
| InChI | InChI=1S/C13H17FO3S.C10H18O3/c1-8-10(15)11(16-2)12(13(14)17-8)18-9-6-4-3-5-7-9;1-6-7(2)13-8(3)9(5-11)10(6)12-4/h3-8,10-13,15H,1-2H3;5-10H,1-4H3 |
| InChIKey | FJOBUWWGAKRHSO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|