C23H36O7S — CID 91427889
4-methoxy-2-methyl-6-phenylsulfanyloxane-3,5-diol;4-methoxy-2,5,6-trimethyloxane-3-carbaldehyde (PubChem CID 91427889) has the molecular formula C23H36O7S and a molecular weight of 456.60 g/mol. Its IUPAC name is 4-methoxy-2-methyl-6-phenylsulfanyloxane-3,5-diol;4-methoxy-2,5,6-trimethyloxane-3-carbaldehyde.
| Compound Name | 4-methoxy-2-methyl-6-phenylsulfanyloxane-3,5-diol;4-methoxy-2,5,6-trimethyloxane-3-carbaldehyde |
|---|---|
| PubChem CID | 91427889 |
| Molecular Formula | C23H36O7S |
| Molecular Weight | 456.60 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 4-methoxy-2-methyl-6-phenylsulfanyloxane-3,5-diol;4-methoxy-2,5,6-trimethyloxane-3-carbaldehyde |
| SMILES | COC1C(C)C(C)OC(C)C1C=O.COC1C(O)C(C)OC(Sc2ccccc2)C1O |
| InChI | InChI=1S/C13H18O4S.C10H18O3/c1-8-10(14)12(16-2)11(15)13(17-8)18-9-6-4-3-5-7-9;1-6-7(2)13-8(3)9(5-11)10(6)12-4/h3-8,10-15H,1-2H3;5-10H,1-4H3 |
| InChIKey | KPNXIWZOFRTXNW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.60 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|