C19H26O4S — CID 71606461
S-(4-methylphenyl) 2-[(2R,4R,5S,6R)-4-hydroxy-5-methyl-6-[(2R)-2-methyl-3-oxopropyl]oxan-2-yl]ethanethioate (PubChem CID 71606461) has the molecular formula C19H26O4S and a molecular weight of 350.48 g/mol. Its IUPAC name is S-(4-methylphenyl) 2-[(2R,4R,5S,6R)-4-hydroxy-5-methyl-6-[(2R)-2-methyl-3-oxopropyl]oxan-2-yl]ethanethioate.
| Compound Name | S-(4-methylphenyl) 2-[(2R,4R,5S,6R)-4-hydroxy-5-methyl-6-[(2R)-2-methyl-3-oxopropyl]oxan-2-yl]ethanethioate |
|---|---|
| PubChem CID | 71606461 |
| Molecular Formula | C19H26O4S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | S-(4-methylphenyl) 2-[(2R,4R,5S,6R)-4-hydroxy-5-methyl-6-[(2R)-2-methyl-3-oxopropyl]oxan-2-yl]ethanethioate |
| SMILES | Cc1ccc(SC(=O)C[C@H]2C[C@@H](O)[C@H](C)[C@@H](C[C@@H](C)C=O)O2)cc1 |
| InChI | InChI=1S/C19H26O4S/c1-12-4-6-16(7-5-12)24-19(22)10-15-9-17(21)14(3)18(23-15)8-13(2)11-20/h4-7,11,13-15,17-18,21H,8-10H2,1-3H3/t13-,14+,15-,17-,18-/m1/s1 |
| InChIKey | CMVPXFDDLLCWRY-JAPOXJDPSA-N |
| XLogP | 3.38 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|