C27H42O5S — CID 59891836
(2R,3S,4S,5S,8R,9S,10R,11S,12S,14R)-3,9,11-trihydroxy-2,4,8,10,12,14-hexamethyl-5-(phenylsulfanylmethyl)cyclotetradecane-1,7-dione (PubChem CID 59891836) has the molecular formula C27H42O5S and a molecular weight of 478.70 g/mol. Its IUPAC name is (2R,3S,4S,5S,8R,9S,10R,11S,12S,14R)-3,9,11-trihydroxy-2,4,8,10,12,14-hexamethyl-5-(phenylsulfanylmethyl)cyclotetradecane-1,7-dione.
| Compound Name | (2R,3S,4S,5S,8R,9S,10R,11S,12S,14R)-3,9,11-trihydroxy-2,4,8,10,12,14-hexamethyl-5-(phenylsulfanylmethyl)cyclotetradecane-1,7-dione |
|---|---|
| PubChem CID | 59891836 |
| Molecular Formula | C27H42O5S |
| Molecular Weight | 478.70 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | (2R,3S,4S,5S,8R,9S,10R,11S,12S,14R)-3,9,11-trihydroxy-2,4,8,10,12,14-hexamethyl-5-(phenylsulfanylmethyl)cyclotetradecane-1,7-dione |
| SMILES | C[C@@H]1[C@@H](O)[C@@H](C)C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)[C@@H](CSc2ccccc2)CC(=O)[C@H](C)[C@H]1O |
| InChI | InChI=1S/C27H42O5S/c1-15-12-16(2)25(30)20(6)27(32)18(4)23(28)13-21(14-33-22-10-8-7-9-11-22)17(3)26(31)19(5)24(15)29/h7-11,15-21,25-27,30-32H,12-14H2,1-6H3/t15-,16+,17+,18+,19+,20-,21-,25+,26+,27-/m1/s1 |
| InChIKey | VUCOUVFNKIXWDA-JYXMAXNMSA-N |
| XLogP | 4.23 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.70 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |