C16H22O7S — CID 141261170
1-[(2R,3S,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)-2-(4-methylphenyl)sulfanyloxan-3-yl]propan-1-one (PubChem CID 141261170) has the molecular formula C16H22O7S and a molecular weight of 358.41 g/mol. Its IUPAC name is 1-[(2R,3S,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)-2-(4-methylphenyl)sulfanyloxan-3-yl]propan-1-one.
| Compound Name | 1-[(2R,3S,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)-2-(4-methylphenyl)sulfanyloxan-3-yl]propan-1-one |
|---|---|
| PubChem CID | 141261170 |
| Molecular Formula | C16H22O7S |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 1-[(2R,3S,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)-2-(4-methylphenyl)sulfanyloxan-3-yl]propan-1-one |
| SMILES | CCC(=O)[C@@]1(O)[C@@H](O)[C@H](O)[C@@H](CO)O[C@@]1(O)Sc1ccc(C)cc1 |
| InChI | InChI=1S/C16H22O7S/c1-3-12(18)15(21)14(20)13(19)11(8-17)23-16(15,22)24-10-6-4-9(2)5-7-10/h4-7,11,13-14,17,19-22H,3,8H2,1-2H3/t11-,13-,14+,15-,16-/m1/s1 |
| InChIKey | YAVSUXNGTQEMNG-YMILTQATSA-N |
| XLogP | -0.44 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|