C20H24O9S — CID 54429380
2-hydroxy-1-[(2S,3R,4S,5S,6S)-3,4,5-triacetyl-3,4,5-trihydroxy-6-phenylsulfanyloxan-2-yl]propan-1-one (PubChem CID 54429380) has the molecular formula C20H24O9S and a molecular weight of 440.47 g/mol. Its IUPAC name is 2-hydroxy-1-[(2S,3R,4S,5S,6S)-3,4,5-triacetyl-3,4,5-trihydroxy-6-phenylsulfanyloxan-2-yl]propan-1-one.
| Compound Name | 2-hydroxy-1-[(2S,3R,4S,5S,6S)-3,4,5-triacetyl-3,4,5-trihydroxy-6-phenylsulfanyloxan-2-yl]propan-1-one |
|---|---|
| PubChem CID | 54429380 |
| Molecular Formula | C20H24O9S |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 2-hydroxy-1-[(2S,3R,4S,5S,6S)-3,4,5-triacetyl-3,4,5-trihydroxy-6-phenylsulfanyloxan-2-yl]propan-1-one |
| SMILES | CC(=O)[C@]1(O)[C@@](O)(C(C)=O)[C@@H](C(=O)C(C)O)O[C@@H](Sc2ccccc2)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C20H24O9S/c1-10(21)15(25)16-18(26,11(2)22)20(28,13(4)24)19(27,12(3)23)17(29-16)30-14-8-6-5-7-9-14/h5-10,16-17,21,26-28H,1-4H3/t10?,16-,17+,18-,19+,20+/m1/s1 |
| InChIKey | WGKAKYVZQXCRQO-LWURVQPJSA-N |
| XLogP | -0.59 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |