C27H42O6S — CID 59891911
(2R,3S,4S,5S,8R,9S,10R,11S,12S,14S)-3,9,11,14-tetrahydroxy-2,4,8,10,12,14-hexamethyl-5-(phenylsulfanylmethyl)cyclotetradecane-1,7-dione (PubChem CID 59891911) has the molecular formula C27H42O6S and a molecular weight of 494.69 g/mol. Its IUPAC name is (2R,3S,4S,5S,8R,9S,10R,11S,12S,14S)-3,9,11,14-tetrahydroxy-2,4,8,10,12,14-hexamethyl-5-(phenylsulfanylmethyl)cyclotetradecane-1,7-dione.
| Compound Name | (2R,3S,4S,5S,8R,9S,10R,11S,12S,14S)-3,9,11,14-tetrahydroxy-2,4,8,10,12,14-hexamethyl-5-(phenylsulfanylmethyl)cyclotetradecane-1,7-dione |
|---|---|
| PubChem CID | 59891911 |
| Molecular Formula | C27H42O6S |
| Molecular Weight | 494.69 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | (2R,3S,4S,5S,8R,9S,10R,11S,12S,14S)-3,9,11,14-tetrahydroxy-2,4,8,10,12,14-hexamethyl-5-(phenylsulfanylmethyl)cyclotetradecane-1,7-dione |
| SMILES | C[C@@H]1[C@@H](O)[C@@H](C)C[C@](C)(O)C(=O)[C@H](C)[C@@H](O)[C@@H](C)[C@@H](CSc2ccccc2)CC(=O)[C@H](C)[C@H]1O |
| InChI | InChI=1S/C27H42O6S/c1-15-13-27(6,33)26(32)19(5)24(30)16(2)20(14-34-21-10-8-7-9-11-21)12-22(28)17(3)25(31)18(4)23(15)29/h7-11,15-20,23-25,29-31,33H,12-14H2,1-6H3/t15-,16-,17-,18+,19+,20+,23-,24-,25+,27-/m0/s1 |
| InChIKey | XVTZWHMYRINENE-SOFAWXKCSA-N |
| XLogP | 3.34 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.69 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |