C17H26O2S — CID 86205255
5-hydroxy-4,6-dimethyl-3-phenylsulfanylnonan-2-one (PubChem CID 86205255) has the molecular formula C17H26O2S and a molecular weight of 294.46 g/mol. Its IUPAC name is 5-hydroxy-4,6-dimethyl-3-phenylsulfanylnonan-2-one.
| Compound Name | 5-hydroxy-4,6-dimethyl-3-phenylsulfanylnonan-2-one |
|---|---|
| PubChem CID | 86205255 |
| Molecular Formula | C17H26O2S |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 5-hydroxy-4,6-dimethyl-3-phenylsulfanylnonan-2-one |
| SMILES | CCCC(C)C(O)C(C)C(Sc1ccccc1)C(C)=O |
| InChI | InChI=1S/C17H26O2S/c1-5-9-12(2)16(19)13(3)17(14(4)18)20-15-10-7-6-8-11-15/h6-8,10-13,16-17,19H,5,9H2,1-4H3 |
| InChIKey | COFMPNBWGVXVKT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |