C20H26O9S — CID 56636880
1-[(2S,3R,4R,5S)-3,4-diacetyl-3,4-dihydroxy-5-[(4-methylphenyl)methylsulfonyl]oxan-2-yl]-2-hydroxypropan-1-one (PubChem CID 56636880) has the molecular formula C20H26O9S and a molecular weight of 442.49 g/mol. Its IUPAC name is 1-[(2S,3R,4R,5S)-3,4-diacetyl-3,4-dihydroxy-5-[(4-methylphenyl)methylsulfonyl]oxan-2-yl]-2-hydroxypropan-1-one.
| Compound Name | 1-[(2S,3R,4R,5S)-3,4-diacetyl-3,4-dihydroxy-5-[(4-methylphenyl)methylsulfonyl]oxan-2-yl]-2-hydroxypropan-1-one |
|---|---|
| PubChem CID | 56636880 |
| Molecular Formula | C20H26O9S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 1-[(2S,3R,4R,5S)-3,4-diacetyl-3,4-dihydroxy-5-[(4-methylphenyl)methylsulfonyl]oxan-2-yl]-2-hydroxypropan-1-one |
| SMILES | CC(=O)[C@@]1(O)[C@@H](C(=O)C(C)O)OC[C@H](S(=O)(=O)Cc2ccc(C)cc2)[C@]1(O)C(C)=O |
| InChI | InChI=1S/C20H26O9S/c1-11-5-7-15(8-6-11)10-30(27,28)16-9-29-18(17(24)12(2)21)20(26,14(4)23)19(16,25)13(3)22/h5-8,12,16,18,21,25-26H,9-10H2,1-4H3/t12?,16-,18+,19+,20+/m0/s1 |
| InChIKey | MKFQEVBUHVWXDK-ZZBVLDCTSA-N |
| XLogP | -0.73 |
| TPSA | 155.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |