C37H39N7O4 — CID 57343984
4-[1-[4-[5-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]pentyl]piperazine-1-carbonyl]imidazo[1,5-a]pyridin-3-yl]benzonitrile (PubChem CID 57343984) has the molecular formula C37H39N7O4 and a molecular weight of 645.76 g/mol. Its IUPAC name is 4-[1-[4-[5-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]pentyl]piperazine-1-carbonyl]imidazo[1,5-a]pyridin-3-yl]benzonitrile.
| Compound Name | 4-[1-[4-[5-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]pentyl]piperazine-1-carbonyl]imidazo[1,5-a]pyridin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 57343984 |
| Molecular Formula | C37H39N7O4 |
| Molecular Weight | 645.76 g/mol |
| Exact Mass | 645.31 |
| IUPAC Name | 4-[1-[4-[5-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]pentyl]piperazine-1-carbonyl]imidazo[1,5-a]pyridin-3-yl]benzonitrile |
| SMILES | COc1cc2c(cc1OCCCCCN1CCN(C(=O)c3nc(-c4ccc(C#N)cc4)n4ccccc34)CC1)N=C[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C37H39N7O4/c1-47-32-22-29-30(39-25-28-8-7-16-43(28)36(29)45)23-33(32)48-21-6-2-4-14-41-17-19-42(20-18-41)37(46)34-31-9-3-5-15-44(31)35(40-34)27-12-10-26(24-38)11-13-27/h3,5,9-13,15,22-23,25,28H,2,4,6-8,14,16-21H2,1H3/t28-/m0/s1 |
| InChIKey | XWEBBDMKPUPMHS-NDEPHWFRSA-N |
| XLogP | 5.21 |
| TPSA | 115.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.76 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|