C21H42O5 — CID 57346745
(12R)-12-hydroxyoctadec-9-enoic acid;propane-1,2-diol (PubChem CID 57346745) has the molecular formula C21H42O5 and a molecular weight of 374.56 g/mol. Its IUPAC name is (12R)-12-hydroxyoctadec-9-enoic acid;propane-1,2-diol.
| Compound Name | (12R)-12-hydroxyoctadec-9-enoic acid;propane-1,2-diol |
|---|---|
| PubChem CID | 57346745 |
| Molecular Formula | C21H42O5 |
| Molecular Weight | 374.56 g/mol |
| Exact Mass | 374.30 |
| IUPAC Name | (12R)-12-hydroxyoctadec-9-enoic acid;propane-1,2-diol |
| SMILES | CC(O)CO.CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O3.C3H8O2/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21;1-3(5)2-4/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21);3-5H,2H2,1H3/t17-;/m1./s1 |
| InChIKey | WJNMPINWDAQWSW-UNTBIKODSA-N |
| XLogP | 4.44 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|