C17H34O6 — CID 57347404
3-oxotetradecanoic acid;propane-1,2,3-triol (PubChem CID 57347404) has the molecular formula C17H34O6 and a molecular weight of 334.45 g/mol. Its IUPAC name is 3-oxotetradecanoic acid;propane-1,2,3-triol.
| Compound Name | 3-oxotetradecanoic acid;propane-1,2,3-triol |
|---|---|
| PubChem CID | 57347404 |
| Molecular Formula | C17H34O6 |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 3-oxotetradecanoic acid;propane-1,2,3-triol |
| SMILES | CCCCCCCCCCCC(=O)CC(=O)O.OCC(O)CO |
| InChI | InChI=1S/C14H26O3.C3H8O3/c1-2-3-4-5-6-7-8-9-10-11-13(15)12-14(16)17;4-1-3(6)2-5/h2-12H2,1H3,(H,16,17);3-6H,1-2H2 |
| InChIKey | OBUIJXGSLHKGIH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|